CAS 890099-84-0
:Methanone, [3-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]-
Description:
Methanone, specifically the compound known as [3-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]-, is an organic molecule characterized by its complex structure that includes both acetyloxy and methylethoxy functional groups attached to phenyl rings. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of the acetyloxy group suggests that it may participate in esterification reactions, while the methylethoxy group can influence its solubility and reactivity. The molecular structure indicates that it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the presence of multiple functional groups can lead to interesting interactions in biological systems, making it a candidate for further study in medicinal chemistry. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various chemical applications.
Formula:C18H18O4
InChI:InChI=1S/C18H18O4/c1-12(2)21-16-9-7-14(8-10-16)18(20)15-5-4-6-17(11-15)22-13(3)19/h4-12H,1-3H3
InChI key:InChIKey=CEPSSVOKNOCGSN-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=C(OC(C)C)C=C2
Synonyms:- Methanone, [3-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]-
- 3-Acetoxy-4′-isopropoxybenzophenone
- 3-(4-Isopropoxybenzoyl)phenyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
