CAS 890099-85-1
:Methanone, [4-(acetyloxy)phenyl](4-propoxyphenyl)-
Description:
Methanone, [4-(acetyloxy)phenyl](4-propoxyphenyl)-, also known by its CAS number 890099-85-1, is an organic compound characterized by its complex structure featuring a methanone functional group. This compound contains two aromatic rings: one substituted with an acetyloxy group and the other with a propoxy group, which contributes to its unique chemical properties. The presence of these substituents can influence the compound's reactivity, solubility, and potential applications in various fields, including pharmaceuticals and materials science. Methanone derivatives often exhibit interesting biological activities, making them subjects of research in medicinal chemistry. Additionally, the compound's molecular structure suggests potential for interactions with biological targets, which may lead to the development of novel therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, including functional group transformations and purification methods. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in scientific research and application.
Formula:C18H18O4
InChI:InChI=1S/C18H18O4/c1-3-12-21-16-8-4-14(5-9-16)18(20)15-6-10-17(11-7-15)22-13(2)19/h4-11H,3,12H2,1-2H3
InChI key:InChIKey=QGRAOSQANLZXGU-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OC(C)=O)C=C1)C2=CC=C(OCCC)C=C2
Synonyms:- Methanone, [4-(acetyloxy)phenyl](4-propoxyphenyl)-
- 4-(4-Propoxybenzoyl)phenyl acetate
- 4-Acetoxy-4′-propoxybenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
