CAS 890099-86-2

Methanone, [3-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]-

Description:

Methanone, [3-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings. The presence of an acetyloxy group at the 3-position of one phenyl ring contributes to its reactivity and potential applications in organic synthesis. The other phenyl ring is substituted with a tert-butyl group at the 4-position, which enhances the compound's steric bulk and hydrophobic properties. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the presence of functional groups indicates that it may participate in various chemical reactions, such as esterification or nucleophilic substitution. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.

Formula: C₁₉H₂₀O₃

InChI: InChI=1S/C19H20O3/c1-13(20)22-17-7-5-6-15(12-17)18(21)14-8-10-16(11-9-14)19(2,3)4/h5-12H,1-4H3

InChI key: InChIKey=QINXEYKCZVHJIU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• 3-Acetoxy-4′-t-butylbenzophenone
• Methanone, [3-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]-

3-Acetoxy-4'-t-butylbenzophenone

CAS: 890099-86-2

Formula: C₁₉H₂₀O₃

Molecular weight: 296.3603

Ref: IN-DA004440