CAS 890099-88-4

[3-(4-ethylbenzoyl)phenyl] acetate

Description:

[3-(4-ethylbenzoyl)phenyl] acetate, with the CAS number 890099-88-4, is an organic compound characterized by its aromatic structure and ester functional group. It features a phenyl ring substituted with an ethylbenzoyl group at the meta position and an acetate group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to exhibit moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic components. The presence of the acetate group suggests that it may participate in reactions typical of esters, such as hydrolysis or transesterification. Additionally, the compound may possess interesting properties related to its potential applications in fields like organic synthesis, fragrance formulation, or as an intermediate in the production of other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₇H₁₆O₃

InChI: InChI=1/C17H16O3/c1-3-13-7-9-14(10-8-13)17(19)15-5-4-6-16(11-15)20-12(2)18/h4-11H,3H2,1-2H3

SMILES: CCc1ccc(cc1)C(=O)c1cccc(c1)OC(=O)C

3-Acetoxy-4′-ethylbenzophenone

CAS: 890099-88-4

Formula: C₁₇H₁₆O₃

Purity: 90.0%

Molecular weight: 268.312

Ref: 10-F201794