CAS 890099-95-3
:[4-(2,3-difluorobenzoyl)phenyl] acetate
Description:
[4-(2,3-Difluorobenzoyl)phenyl] acetate, with the CAS number 890099-95-3, is an organic compound characterized by its aromatic structure and the presence of both an acetate functional group and a difluorobenzoyl moiety. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its non-polar aromatic characteristics. The difluorobenzoyl group introduces unique electronic properties, which can influence its reactivity and interactions with other molecules. The presence of fluorine atoms often enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, [4-(2,3-difluorobenzoyl)phenyl] acetate represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.
Formula:C15H10F2O3
InChI:InChI=1/C15H10F2O3/c1-9(18)20-11-7-5-10(6-8-11)15(19)12-3-2-4-13(16)14(12)17/h2-8H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1cccc(c1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
