CymitQuimica logo

CAS 890099-96-4

:

[3-(4-hexylbenzoyl)phenyl] acetate

Description:
[3-(4-Hexylbenzoyl)phenyl] acetate, with the CAS number 890099-96-4, is an organic compound characterized by its aromatic structure and ester functional group. This substance features a phenyl ring substituted with a hexylbenzoyl group at the meta position and an acetate group. The presence of the hexyl chain contributes to its hydrophobic properties, while the ester functionality can influence its reactivity and solubility in various solvents. Typically, compounds like this may exhibit properties such as moderate to low volatility, potential UV absorption characteristics, and possible applications in materials science, particularly in the development of organic light-emitting diodes (OLEDs) or as intermediates in organic synthesis. Additionally, the molecular structure suggests that it may have specific interactions with biological systems, warranting further investigation into its safety and environmental impact. Overall, [3-(4-hexylbenzoyl)phenyl] acetate represents a class of compounds with diverse applications in chemistry and materials science.
Formula:C21H24O3
InChI:InChI=1/C21H24O3/c1-3-4-5-6-8-17-11-13-18(14-12-17)21(23)19-9-7-10-20(15-19)24-16(2)22/h7,9-15H,3-6,8H2,1-2H3
SMILES:CCCCCCc1ccc(cc1)C(=O)c1cccc(c1)OC(=O)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.