CAS 890099-97-5

Methanone, [4-(acetyloxy)phenyl](2,4-difluorophenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](2,4-difluorophenyl)-, also known by its CAS number 890099-97-5, is an organic compound characterized by its complex structure that includes a methanone functional group and two aromatic rings. The presence of the acetyloxy group indicates that it has an ester functional group, which can influence its reactivity and solubility. The difluorophenyl moiety suggests that the compound may exhibit unique electronic properties due to the electronegative fluorine atoms, potentially affecting its chemical behavior and interactions. This compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals or materials science, given its structural features. Its synthesis and reactivity would be of interest in organic chemistry, particularly in the context of developing new compounds with specific biological or chemical properties. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₅H₁₀F₂O₃

InChI: InChI=1S/C15H10F2O3/c1-9(18)20-12-5-2-10(3-6-12)15(19)13-7-4-11(16)8-14(13)17/h2-8H,1H3

InChI key: InChIKey=SEQMEXMJEMBEOE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• Methanone, [4-(acetyloxy)phenyl](2,4-difluorophenyl)-

4-Acetoxy-2',4'-difluorobenzophenone

CAS: 890099-97-5

Formula: C₁₅H₁₀F₂O₃

Molecular weight: 276.2349

Ref: IN-DA0044NY