CAS 890099-98-6
:Methanone, [3-(acetyloxy)phenyl](4-heptylphenyl)-
Description:
Methanone, [3-(acetyloxy)phenyl](4-heptylphenyl)-, also known by its CAS number 890099-98-6, is an organic compound characterized by its complex structure featuring a methanone functional group. This compound includes a phenyl ring substituted with an acetyloxy group at the 3-position and a heptylphenyl group at the 4-position. The presence of the acetyloxy group suggests that it may exhibit reactivity typical of esters, while the heptyl chain contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The molecular structure indicates that it may have applications in organic synthesis or materials science, particularly in the development of liquid crystals or other functional materials. Additionally, the compound's unique substituents may impart specific optical or electronic properties, making it of interest in various chemical research fields. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C22H26O3
InChI:InChI=1S/C22H26O3/c1-3-4-5-6-7-9-18-12-14-19(15-13-18)22(24)20-10-8-11-21(16-20)25-17(2)23/h8,10-16H,3-7,9H2,1-2H3
InChI key:InChIKey=ABKMOVOIYWOPMD-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=C(CCCCCCC)C=C2
Synonyms:- 3-(4-Heptylbenzoyl)phenyl acetate
- 3-Acetoxy-4′-heptylbenzophenone
- Methanone, [3-(acetyloxy)phenyl](4-heptylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
