CAS 890100-02-4

Methanone, [3-(acetyloxy)phenyl](4-propoxyphenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](4-propoxyphenyl)-, also known by its CAS number 890100-02-4, is an organic compound characterized by its complex structure that includes both acetyloxy and propoxy functional groups attached to a phenyl ring. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for undergoing electrophilic substitution reactions. The presence of the acetyloxy group suggests that it may participate in esterification reactions, while the propoxy group can influence its solubility and reactivity. Methanone derivatives often display interesting biological activities, making them of interest in medicinal chemistry. The compound's molecular structure may also impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular forces like hydrogen bonding and van der Waals interactions. Overall, this compound's unique functional groups and aromatic nature contribute to its potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₈H₁₈O₄

InChI: InChI=1S/C18H18O4/c1-3-11-21-16-9-7-14(8-10-16)18(20)15-5-4-6-17(12-15)22-13(2)19/h4-10,12H,3,11H2,1-2H3

InChI key: InChIKey=VCLOIJIZXANBOI-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=C(OCCC)C=C2

Synonyms:

• 3-(4-Propoxybenzoyl)phenyl acetate
• 3-Acetoxy-4′-propoxybenzophenone
• Methanone, [3-(acetyloxy)phenyl](4-propoxyphenyl)-

3-Acetoxy-4'-propoxybenzophenone

CAS: 890100-02-4

Formula: C₁₈H₁₈O₄

Molecular weight: 298.3331

Ref: IN-DA0042VM