CAS 890100-03-5

[4-(Acetyloxy)phenyl](3,4-difluorophenyl)methanone

Description:

[4-(Acetyloxy)phenyl](3,4-difluorophenyl)methanone, with the CAS number 890100-03-5, is an organic compound characterized by its complex structure, which includes an acetyloxy group and a difluorophenyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and reactivity due to the presence of the carbonyl group. The acetyloxy group can enhance solubility in organic solvents and may influence the compound's reactivity in various chemical reactions, including nucleophilic substitutions. The difluorophenyl group introduces electronegative fluorine atoms, which can affect the electronic properties of the molecule, potentially increasing its lipophilicity and altering its interaction with biological targets. This compound may be of interest in medicinal chemistry and materials science due to its unique structural features, which could lead to specific biological activities or applications in drug development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.

Formula: C₁₅H₁₀F₂O₃

InChI: InChI=1S/C15H10F2O3/c1-9(18)20-12-5-2-10(3-6-12)15(19)11-4-7-13(16)14(17)8-11/h2-8H,1H3

InChI key: InChIKey=YJDWKYCNDKBUPS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC(C)=O)C=C1)C2=CC(F)=C(F)C=C2

Synonyms:

• 4-Acetoxy-3′,4′-difluorobenzophenone
• [4-(Acetyloxy)phenyl](3,4-difluorophenyl)methanone
• Methanone, [4-(acetyloxy)phenyl](3,4-difluorophenyl)-

4-Acetoxy-3',4'-difluorobenzophenone

CAS: 890100-03-5

Formula: C₁₅H₁₀F₂O₃

Molecular weight: 276.2349

Ref: IN-DA0042VL