CAS 890100-04-6
:Methanone, [3-(acetyloxy)phenyl](4-butoxyphenyl)-
Description:
Methanone, [3-(acetyloxy)phenyl](4-butoxyphenyl)-, also known by its CAS number 890100-04-6, is an organic compound characterized by its complex structure featuring a methanone functional group. This compound includes a phenyl ring substituted with an acetyloxy group at the 3-position and a butoxy group at the 4-position of another phenyl ring. The presence of these substituents contributes to its chemical properties, such as solubility and reactivity. Methanone derivatives often exhibit interesting biological activities, making them of interest in medicinal chemistry and material science. The acetyloxy group can enhance the compound's lipophilicity, potentially influencing its interaction with biological membranes. Additionally, the butoxy group may affect the compound's physical properties, such as melting and boiling points. Overall, this compound's unique structure and functional groups suggest potential applications in various fields, including pharmaceuticals and organic synthesis. However, specific data on its reactivity, stability, and biological activity would require further investigation.
Formula:C19H20O4
InChI:InChI=1S/C19H20O4/c1-3-4-12-22-17-10-8-15(9-11-17)19(21)16-6-5-7-18(13-16)23-14(2)20/h5-11,13H,3-4,12H2,1-2H3
InChI key:InChIKey=SQYSJOCYZOJXKK-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=C(OCCCC)C=C2
Synonyms:- 3-(4-Butoxybenzoyl)phenyl acetate
- Methanone, [3-(acetyloxy)phenyl](4-butoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
