CAS 890100-05-7
:Methanone, [4-(acetyloxy)phenyl](3,5-difluorophenyl)-
Description:
Methanone, [4-(acetyloxy)phenyl](3,5-difluorophenyl)-, also known by its CAS number 890100-05-7, is an organic compound characterized by its complex structure featuring both acetyloxy and difluorophenyl groups. This compound typically exhibits a molecular framework that includes a ketone functional group, which is indicative of its classification as a methanone. The presence of the acetyloxy group suggests potential reactivity in esterification or acylation reactions, while the difluorophenyl moiety may impart unique electronic properties and influence the compound's overall polarity and solubility. The fluorine atoms can enhance the compound's stability and alter its interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's structural features may contribute to its potential applications in pharmaceuticals or agrochemicals. Overall, the characteristics of this compound highlight its significance in various chemical contexts, particularly in the development of new materials or therapeutic agents.
Formula:C15H10F2O3
InChI:InChI=1S/C15H10F2O3/c1-9(18)20-14-4-2-10(3-5-14)15(19)11-6-12(16)8-13(17)7-11/h2-8H,1H3
InChI key:InChIKey=BSUYOASASRMVJK-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(OC(C)=O)C=C2
Synonyms:- Methanone, [4-(acetyloxy)phenyl](3,5-difluorophenyl)-
- 4-(3,5-Difluorobenzoyl)phenyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
