CAS 890100-06-8
:[3-(4-pentoxybenzoyl)phenyl] acetate
Description:
[3-(4-pentoxybenzoyl)phenyl] acetate, with the CAS number 890100-06-8, is an organic compound characterized by its aromatic structure and ester functional group. This substance features a phenyl ring substituted with a pentoxybenzoyl group, which contributes to its hydrophobic properties and potential applications in various fields, including materials science and pharmaceuticals. The presence of the acetate moiety indicates that it can undergo hydrolysis, leading to the release of acetic acid and the corresponding phenolic compound. Its molecular structure suggests that it may exhibit interesting thermal and photochemical properties, making it suitable for use in UV-curable coatings or as a potential intermediate in organic synthesis. Additionally, the compound's solubility characteristics may vary depending on the solvent used, influencing its behavior in different chemical environments. Overall, [3-(4-pentoxybenzoyl)phenyl] acetate is a versatile compound with potential applications in both industrial and research settings.
Formula:C20H22O4
InChI:InChI=1/C20H22O4/c1-3-4-5-13-23-18-11-9-16(10-12-18)20(22)17-7-6-8-19(14-17)24-15(2)21/h6-12,14H,3-5,13H2,1-2H3
SMILES:CCCCCOc1ccc(cc1)C(=O)c1cccc(c1)OC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
