CAS 890100-09-1
:[4-(2,4-dichlorobenzoyl)phenyl] acetate
Description:
[4-(2,4-Dichlorobenzoyl)phenyl] acetate, with the CAS number 890100-09-1, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with a dichlorobenzoyl group and an acetate moiety. This compound typically exhibits properties common to aromatic esters, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic nature. The presence of the dichlorobenzoyl group contributes to its potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound may exhibit specific reactivity patterns typical of esters, such as hydrolysis under acidic or basic conditions. Additionally, its molecular structure suggests potential for interactions with biological targets, which could be explored in medicinal chemistry. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental impact. Overall, [4-(2,4-dichlorobenzoyl)phenyl] acetate represents a compound of interest for further research and application in chemical synthesis and biological studies.
Formula:C15H10Cl2O3
InChI:InChI=1/C15H10Cl2O3/c1-9(18)20-12-5-2-10(3-6-12)15(19)13-7-4-11(16)8-14(13)17/h2-8H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1ccc(cc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.