CAS 890100-11-5

Methanone, [4-(acetyloxy)phenyl](2,6-dichlorophenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](2,6-dichlorophenyl)-, also known by its CAS number 890100-11-5, is an organic compound characterized by its complex structure featuring both acetyloxy and dichlorophenyl groups. This compound typically exhibits properties associated with aromatic ketones, including a relatively high melting point and solubility in organic solvents. The presence of the acetyloxy group suggests potential reactivity in nucleophilic substitution reactions, while the dichlorophenyl moiety may impart unique electronic properties and influence the compound's overall stability and reactivity. Methanone derivatives often find applications in pharmaceuticals and agrochemicals due to their biological activity, which can include antimicrobial or anti-inflammatory properties. The specific interactions and behaviors of this compound in various chemical environments can be influenced by factors such as pH, temperature, and the presence of other reactive species. Overall, this compound represents a significant interest in synthetic organic chemistry and material science.

Formula: C₁₅H₁₀Cl₂O₃

InChI: InChI=1S/C15H10Cl2O3/c1-9(18)20-11-7-5-10(6-8-11)15(19)14-12(16)3-2-4-13(14)17/h2-8H,1H3

InChI key: InChIKey=TVVOHCKPUMLKEE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC=C1Cl)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• 4-Acetoxy-2′,6′-dichlorobenzophenone
• Methanone, [4-(acetyloxy)phenyl](2,6-dichlorophenyl)-
• 4-(2,6-Dichlorobenzoyl)phenyl acetate

4-Acetoxy-2',6'-dichlorobenzophenone

CAS: 890100-11-5

Formula: C₁₅H₁₀Cl₂O₃

Molecular weight: 309.1441

Ref: IN-DA0044NV