CAS 890100-12-6

Methanone, [3-(acetyloxy)phenyl](2,3-difluorophenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](2,3-difluorophenyl)-, also known by its CAS number 890100-12-6, is an organic compound characterized by its complex structure that includes both acetyloxy and difluorophenyl groups. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the presence of the carbonyl group, which can influence its solubility in various solvents. The acetyloxy group introduces additional reactivity, making it a potential candidate for further chemical transformations. The presence of fluorine atoms in the difluorophenyl moiety can enhance the compound's lipophilicity and alter its electronic properties, potentially impacting its biological activity. Methanone derivatives often find applications in pharmaceuticals and agrochemicals due to their ability to interact with biological systems. Overall, this compound's unique functional groups and structural features contribute to its potential utility in various chemical and medicinal applications.

Formula: C₁₅H₁₀F₂O₃

InChI: InChI=1S/C15H10F2O3/c1-9(18)20-11-5-2-4-10(8-11)15(19)12-6-3-7-13(16)14(12)17/h2-8H,1H3

InChI key: InChIKey=SRVXZQKDUPNOSA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=C(F)C(F)=CC=C2

Synonyms:

• 3-(2,3-Difluorobenzoyl)phenyl acetate
• Methanone, [3-(acetyloxy)phenyl](2,3-difluorophenyl)-
• 3-Acetoxy-2′,3′-difluorobenzophenone