CAS 890100-14-8
:[3-(Acetyloxy)phenyl](2,4-difluorophenyl)methanone
Description:
[3-(Acetyloxy)phenyl](2,4-difluorophenyl)methanone, with the CAS number 890100-14-8, is a synthetic organic compound characterized by its complex structure, which includes an acetyloxy group and a difluorophenyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and potential reactivity due to the presence of the carbonyl group. The acetyloxy group can influence its solubility and reactivity, making it more polar compared to non-substituted phenyl ketones. The difluorophenyl substituent introduces electron-withdrawing effects, which can enhance the compound's electrophilicity and alter its chemical behavior in reactions. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing more complex molecules. Additionally, its unique structural features may contribute to specific interactions in biological systems, warranting further investigation into its pharmacological properties. Overall, [3-(Acetyloxy)phenyl](2,4-difluorophenyl)methanone represents a versatile compound with potential applications in various fields of chemistry.
Formula:C15H10F2O3
InChI:InChI=1/C15H10F2O3/c1-9(18)20-12-4-2-3-10(7-12)15(19)13-6-5-11(16)8-14(13)17/h2-8H,1H3
InChI key:InChIKey=QPXHPVPLPZMNEY-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=C(F)C=C(F)C=C2
Synonyms:- Methanone, [3-(acetyloxy)phenyl](2,4-difluorophenyl)-
- [3-(Acetyloxy)phenyl](2,4-difluorophenyl)methanone
- 3-(2,4-Difluorobenzoyl)phenyl acetate
- 3-Acetoxy-2′,4′-difluorobenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
