CAS 890100-15-9
:[4-(3,5-dichlorobenzoyl)phenyl] acetate
Description:
[4-(3,5-Dichlorobenzoyl)phenyl] acetate, with the CAS number 890100-15-9, is an organic compound characterized by its complex aromatic structure. It features a phenyl acetate moiety substituted with a 3,5-dichlorobenzoyl group, which contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the solvent's polarity. The presence of chlorine atoms in the structure enhances its lipophilicity and may influence its reactivity and biological activity. As a derivative of phenyl acetate, it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Its potential applications could span across fields such as pharmaceuticals, agrochemicals, or materials science, where it may serve as an intermediate or a functional component. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, [4-(3,5-dichlorobenzoyl)phenyl] acetate is a notable compound with specific characteristics that warrant further investigation for its applications.
Formula:C15H10Cl2O3
InChI:InChI=1/C15H10Cl2O3/c1-9(18)20-14-4-2-10(3-5-14)15(19)11-6-12(16)8-13(17)7-11/h2-8H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
