CAS 890100-16-0

Methanone, [3-(acetyloxy)phenyl](2,5-difluorophenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](2,5-difluorophenyl)-, also known by its CAS number 890100-16-0, is an organic compound characterized by its complex structure that includes both acetyloxy and difluorophenyl groups. This compound features a methanone functional group, which is indicative of a ketone, and is further substituted with a phenyl ring that has an acetyloxy group at the meta position. The presence of two fluorine atoms on the second phenyl ring enhances its chemical reactivity and may influence its physical properties, such as solubility and boiling point. Methanone derivatives often exhibit interesting biological activities, making them of interest in medicinal chemistry. The acetyloxy group can also serve as a protective or activating group in synthetic pathways. Overall, this compound's unique functional groups and substituents contribute to its potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₅H₁₀F₂O₃

InChI: InChI=1S/C15H10F2O3/c1-9(18)20-12-4-2-3-10(7-12)15(19)13-8-11(16)5-6-14(13)17/h2-8H,1H3

InChI key: InChIKey=BBCKVVKVTBAVSU-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=CC(F)=C1)C2=CC(OC(C)=O)=CC=C2

Synonyms:

• Methanone, [3-(acetyloxy)phenyl](2,5-difluorophenyl)-
• 3-(2,5-Difluorobenzoyl)phenyl acetate