CymitQuimica logo

CAS 890100-18-2

:

Methanone, [3-(acetyloxy)phenyl](2,6-difluorophenyl)-

Description:
Methanone, [3-(acetyloxy)phenyl](2,6-difluorophenyl)-, also known by its CAS number 890100-18-2, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. The presence of the acetyloxy group indicates that it has an ester functional group, which can influence its reactivity and solubility. The difluorophenyl substituent suggests that the compound may exhibit unique electronic properties due to the electronegative fluorine atoms, potentially affecting its chemical behavior and interactions. This compound may be of interest in medicinal chemistry or materials science due to its potential biological activity or utility in synthesizing other chemical entities. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity.
Formula:C15H10F2O3
InChI:InChI=1S/C15H10F2O3/c1-9(18)20-11-5-2-4-10(8-11)15(19)14-12(16)6-3-7-13(14)17/h2-8H,1H3
InChI key:InChIKey=SRASUQOAINAVOQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=CC=C1F)C2=CC(OC(C)=O)=CC=C2
Synonyms:
  • Methanone, [3-(acetyloxy)phenyl](2,6-difluorophenyl)-
  • 3-Acetoxy-2′,6′-difluorobenzophenone
  • 3-(2,6-Difluorobenzoyl)phenyl acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.