CAS 890100-20-6

Methanone, [3-(acetyloxy)phenyl](3,4-difluorophenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](3,4-difluorophenyl)-, also known by its CAS number 890100-20-6, is an organic compound characterized by its complex structure featuring a methanone functional group. This compound includes a phenyl ring substituted with an acetyloxy group at the 3-position and a difluorophenyl group at the 3,4-positions. The presence of the acetyloxy group suggests that it may exhibit reactivity typical of esters, while the difluorophenyl moiety introduces unique electronic properties due to the electronegative fluorine atoms. Such substitutions can influence the compound's polarity, solubility, and potential biological activity. Methanone derivatives often serve as intermediates in organic synthesis and may have applications in pharmaceuticals or agrochemicals. The specific arrangement of substituents can affect the compound's stability, reactivity, and interaction with biological targets, making it of interest in medicinal chemistry and materials science.

Formula: C₁₅H₁₀F₂O₃

InChI: InChI=1S/C15H10F2O3/c1-9(18)20-12-4-2-3-10(7-12)15(19)11-5-6-13(16)14(17)8-11/h2-8H,1H3

InChI key: InChIKey=RPGCVLGDEDNIAM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C=C1)C2=CC(OC(C)=O)=CC=C2

Synonyms:

• 3-Acetoxy-3′,4′-difluorobenzophenone
• Methanone, [3-(acetyloxy)phenyl](3,4-difluorophenyl)-

3-Acetoxy-3',4'-difluorobenzophenone

CAS: 890100-20-6

Formula: C₁₅H₁₀F₂O₃

Molecular weight: 276.2349

Ref: IN-DA0044NU