CAS 890100-24-0

Methanone, [3-(acetyloxy)phenyl](2,3-dichlorophenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](2,3-dichlorophenyl)-, also known by its CAS number 890100-24-0, is an organic compound characterized by its complex structure that includes a methanone functional group, an acetyloxy group, and dichlorophenyl moieties. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions due to the presence of electron-withdrawing groups like the dichloro substituents. The acetyloxy group enhances its reactivity, making it a potential candidate for various chemical reactions, including esterification and acylation. Its molecular structure suggests that it may have applications in pharmaceuticals or agrochemicals, where such functional groups are often utilized for biological activity. Additionally, the presence of chlorine atoms can influence its solubility and reactivity, making it a subject of interest in synthetic organic chemistry. Overall, this compound exemplifies the diverse functionalities that can be achieved through careful molecular design.

Formula: C₁₅H₁₀Cl₂O₃

InChI: InChI=1S/C15H10Cl2O3/c1-9(18)20-11-5-2-4-10(8-11)15(19)12-6-3-7-13(16)14(12)17/h2-8H,1H3

InChI key: InChIKey=SDWHLASSSOMWLQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=C(Cl)C(Cl)=CC=C2

Synonyms:

• Methanone, [3-(acetyloxy)phenyl](2,3-dichlorophenyl)-
• 3-Acetoxy-2′,3′-dichlorobenzophenone
• 3-(2,3-Dichlorobenzoyl)phenyl acetate

3-Acetoxy-2',3'-dichlorobenzophenone

CAS: 890100-24-0

Formula: C₁₅H₁₀Cl₂O₃

Molecular weight: 309.1441

Ref: IN-DA0044NS