CAS 890100-25-1

Methanone, [4-(acetyloxy)phenyl](3,4-dimethoxyphenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](3,4-dimethoxyphenyl)-, also known by its CAS number 890100-25-1, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. This compound features a phenyl group substituted with an acetyloxy group at one position and a dimethoxy group at another, contributing to its chemical reactivity and potential applications. The presence of the methanone moiety indicates that it may participate in various chemical reactions, such as nucleophilic additions or substitutions. The acetyloxy group can enhance solubility and reactivity, while the dimethoxy groups can influence the electronic properties of the molecule, potentially affecting its biological activity. This compound may be of interest in medicinal chemistry and materials science due to its unique structural features, which could lead to the development of novel pharmaceuticals or functional materials. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₇H₁₆O₅

InChI: InChI=1S/C17H16O5/c1-11(18)22-14-7-4-12(5-8-14)17(19)13-6-9-15(20-2)16(10-13)21-3/h4-10H,1-3H3

InChI key: InChIKey=OSPYVKUTNYBQCV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=C(OC)C=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• Methanone, [4-(acetyloxy)phenyl](3,4-dimethoxyphenyl)-
• 4-(3,4-Dimethoxybenzoyl)phenyl acetate

4-Acetoxy-3′,4′-dimethoxybenzophenone

CAS: 890100-25-1

Formula: C₁₇H₁₆O₅

Purity: 90.0%

Molecular weight: 300.31

Ref: 10-F201891