CAS 890100-26-2
:[3-(2,4-dichlorobenzoyl)phenyl] acetate
Description:
[3-(2,4-Dichlorobenzoyl)phenyl] acetate is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with a 2,4-dichlorobenzoyl group and an acetate moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the dichlorobenzoyl group suggests that it may have significant biological activity, potentially acting as a pharmaceutical intermediate or a pesticide. Its acetate functional group can influence solubility and reactivity, making it a versatile compound in synthetic organic chemistry. The molecular structure contributes to its physical properties, such as melting and boiling points, which are influenced by intermolecular forces like van der Waals interactions and dipole-dipole interactions due to the presence of chlorine atoms. Additionally, the compound's reactivity may be explored in various chemical syntheses or applications in materials science. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with halogen substituents.
Formula:C15H10Cl2O3
InChI:InChI=1/C15H10Cl2O3/c1-9(18)20-12-4-2-3-10(7-12)15(19)13-6-5-11(16)8-14(13)17/h2-8H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1ccc(cc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
