CAS 890100-28-4
:[3-(2,5-dichlorobenzoyl)phenyl] acetate
Description:
[3-(2,5-Dichlorobenzoyl)phenyl] acetate, with the CAS number 890100-28-4, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with a dichlorobenzoyl group and an acetate moiety. This compound typically exhibits properties common to aromatic esters, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic nature. The presence of chlorine atoms in the dichlorobenzoyl group can impart unique electronic and steric effects, potentially influencing its reactivity and interactions with biological systems. The compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis often involves acylation reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C15H10Cl2O3
InChI:InChI=1/C15H10Cl2O3/c1-9(18)20-12-4-2-3-10(7-12)15(19)13-8-11(16)5-6-14(13)17/h2-8H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1cc(ccc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
