CAS 890100-29-5
:[4-(2,3-dimethylbenzoyl)phenyl] acetate
Description:
[4-(2,3-Dimethylbenzoyl)phenyl] acetate, with the CAS number 890100-29-5, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with an acetate group and a 2,3-dimethylbenzoyl moiety, contributing to its unique chemical properties. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while its acetate group may impart some polar characteristics. The presence of the dimethyl groups can influence its steric hindrance and electronic properties, potentially affecting its reactivity and interactions with other molecules. As a derivative of acetophenone, it may be involved in various chemical reactions, including acylation and esterification. Additionally, compounds of this nature can be of interest in fields such as materials science, pharmaceuticals, and organic synthesis, where they may serve as intermediates or functional materials. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C17H16O3
InChI:InChI=1/C17H16O3/c1-11-5-4-6-16(12(11)2)17(19)14-7-9-15(10-8-14)20-13(3)18/h4-10H,1-3H3
SMILES:Cc1cccc(c1C)C(=O)c1ccc(cc1)OC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
