CAS 890100-32-0

Methanone, [3-(acetyloxy)phenyl](3,4-dichlorophenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](3,4-dichlorophenyl)-, also known by its CAS number 890100-32-0, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. This compound features a phenyl group substituted with an acetyloxy group at the para position and a dichlorophenyl group at the meta position. The presence of the acetyloxy group suggests that it may exhibit ester-like properties, potentially influencing its reactivity and solubility in various solvents. The dichlorophenyl moiety indicates that the compound may possess significant electron-withdrawing characteristics, which can affect its chemical behavior and interactions with other substances. Methanone derivatives often find applications in pharmaceuticals, agrochemicals, and materials science due to their diverse biological activities and functional properties. However, specific applications and biological activities would depend on further studies and evaluations of this particular compound.

Formula: C₁₅H₁₀Cl₂O₃

InChI: InChI=1S/C15H10Cl2O3/c1-9(18)20-12-4-2-3-10(7-12)15(19)11-5-6-13(16)14(17)8-11/h2-8H,1H3

InChI key: InChIKey=BNPDAJSVJKSAGM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC(OC(C)=O)=CC=C2

Synonyms:

• Methanone, [3-(acetyloxy)phenyl](3,4-dichlorophenyl)-
• 3-Acetoxy-3′,4′-dichlorobenzophenone

3-Acetoxy-3′,4′-dichlorobenzophenone

CAS: 890100-32-0

Formula: C₁₅H₁₀Cl₂O₃

Purity: 90.0%

Molecular weight: 309.14

Ref: 10-F201816