CAS 890100-34-2

[3-(Acetyloxy)phenyl](3,5-dichlorophenyl)methanone

Description:

The chemical substance known as [3-(Acetyloxy)phenyl](3,5-dichlorophenyl)methanone, with the CAS number 890100-34-2, is an organic compound characterized by its complex structure, which includes both acetyloxy and dichlorophenyl functional groups. This compound typically exhibits properties associated with aromatic ketones, such as stability and reactivity due to the presence of the carbonyl group. The acetyloxy group contributes to its potential as an ester, influencing its solubility and reactivity in various chemical environments. The dichlorophenyl moiety enhances its biological activity and may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of chlorine atoms can affect the compound's electronic properties and lipophilicity, which are crucial for its interaction with biological targets. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through empirical studies.

Formula: C₁₅H₁₀Cl₂O₃

InChI: InChI=1S/C15H10Cl2O3/c1-9(18)20-14-4-2-3-10(7-14)15(19)11-5-12(16)8-13(17)6-11/h2-8H,1H3

InChI key: InChIKey=PVDIUKSETSQTBD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC(OC(C)=O)=CC=C2

Synonyms:

• 3-(3,5-Dichlorobenzoyl)phenyl acetate
• 3-Acetoxy-3′,5′-dichlorobenzophenone
• [3-(Acetyloxy)phenyl](3,5-dichlorophenyl)methanone
• Methanone, [3-(acetyloxy)phenyl](3,5-dichlorophenyl)-

3-Acetoxy-3′,5′-dichlorobenzophenone

CAS: 890100-34-2

Formula: C₁₅H₁₀Cl₂O₃

Purity: 90.0%

Molecular weight: 309.14

Ref: 10-F201817