CAS 890100-35-3

Methanone, [4-(acetyloxy)phenyl](3,4-dimethylphenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](3,4-dimethylphenyl)-, also known by its CAS number 890100-35-3, is an organic compound characterized by its complex structure that includes a methanone functional group and aromatic rings. This compound features a phenyl group substituted with an acetyloxy group at the para position, along with another phenyl group that has two methyl substituents at the 3 and 4 positions. The presence of the acetyloxy group suggests that it may exhibit reactivity typical of esters, potentially participating in hydrolysis or transesterification reactions. The aromatic rings contribute to the compound's stability and may influence its electronic properties, making it useful in various chemical applications, including potential roles in pharmaceuticals or as intermediates in organic synthesis. Additionally, the presence of multiple functional groups may impart specific solubility characteristics and biological activity, warranting further investigation into its properties and potential uses in different chemical contexts.

Formula: C₁₇H₁₆O₃

InChI: InChI=1S/C17H16O3/c1-11-4-5-15(10-12(11)2)17(19)14-6-8-16(9-7-14)20-13(3)18/h4-10H,1-3H3

InChI key: InChIKey=DEXWPUINOVTLOS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC(C)=O)C=C1)C2=CC(C)=C(C)C=C2

Synonyms:

• 4-Acetoxy-3′,4′-dimethylbenzophenone
• 4-(3,4-Dimethylbenzoyl)phenyl acetate
• Methanone, [4-(acetyloxy)phenyl](3,4-dimethylphenyl)-

4-Acetoxy-3',4'-dimethylbenzophenone

CAS: 890100-35-3

Formula: C₁₇H₁₆O₃

Molecular weight: 268.3071

Ref: IN-DA0044NP

4-Acetoxy-3′,4′-dimethylbenzophenone

CAS: 890100-35-3

Formula: C₁₇H₁₆O₃

Purity: 90.0%

Molecular weight: 268.312

Ref: 10-F201897