CAS 890100-39-7

[4-(3,4,5-trifluorobenzoyl)phenyl] acetate

Description:

[4-(3,4,5-trifluorobenzoyl)phenyl] acetate, with the CAS number 890100-39-7, is an organic compound characterized by its aromatic structure and the presence of a trifluorobenzoyl group. This compound features a phenyl ring substituted with an acetate group and a trifluorobenzoyl moiety, which contributes to its unique chemical properties. The trifluoromethyl groups enhance the compound's lipophilicity and may influence its reactivity and interaction with biological systems. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of fluorine atoms often imparts increased stability and altered solubility characteristics compared to their non-fluorinated counterparts. Additionally, the compound may be utilized in various applications, including as an intermediate in organic synthesis or in the development of agrochemicals and pharmaceuticals. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₅H₉F₃O₃

InChI: InChI=1/C15H9F3O3/c1-8(19)21-11-4-2-9(3-5-11)15(20)10-6-12(16)14(18)13(17)7-10/h2-7H,1H3

SMILES: CC(=O)Oc1ccc(cc1)C(=O)c1cc(c(c(c1)F)F)F

4-Acetoxy-3',4',5'-trifluorobenzophenone

CAS: 890100-39-7

Formula: C₁₅H₉F₃O₃

Molecular weight: 294.2254

Ref: IN-DA0044NN