CymitQuimica logo

CAS 890100-41-1

:

[4-(2,3,4,5,6-pentafluorobenzoyl)phenyl] acetate

Description:
[4-(2,3,4,5,6-pentafluorobenzoyl)phenyl] acetate, with the CAS number 890100-41-1, is an organic compound characterized by its complex aromatic structure. It features a phenyl acetate moiety substituted with a pentafluorobenzoyl group, which significantly enhances its chemical reactivity and polarity due to the presence of multiple fluorine atoms. The pentafluorobenzoyl group contributes to the compound's unique electronic properties, making it useful in various applications, including as a reagent in organic synthesis and in materials science. The presence of fluorine atoms typically imparts increased thermal stability and hydrophobic characteristics, which can influence solubility in different solvents. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for studies in fluorescence or as a potential intermediate in the synthesis of more complex fluorinated compounds. Overall, its distinctive structure and properties make it a subject of interest in both academic and industrial research settings.
Formula:C15H7F5O3
InChI:InChI=1/C15H7F5O3/c1-6(21)23-8-4-2-7(3-5-8)15(22)9-10(16)12(18)14(20)13(19)11(9)17/h2-5H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1c(c(c(c(c1F)F)F)F)F
Synonyms:
  • Methanone, [4-(acetyloxy)phenyl](2,3,4,5,6-pentafluorophenyl)-
  • 4-(Perfluorobenzoyl)phenyl acetate
  • 4-ACETOXY-2',3',4',5',6'-PENTAFLUOROBENZOPHENONE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.