CAS 890100-42-2

Methanone, [3-(acetyloxy)phenyl](3,4-dimethoxyphenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](3,4-dimethoxyphenyl)-, also known by its CAS number 890100-42-2, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. This compound features a phenyl group substituted with an acetyloxy group at the 3-position, which enhances its reactivity and solubility in organic solvents. Additionally, it contains a 3,4-dimethoxyphenyl group, contributing to its potential applications in organic synthesis and medicinal chemistry. The presence of methoxy groups typically increases the electron density of the aromatic rings, influencing the compound's chemical behavior and interactions. Methanone derivatives are often studied for their biological activities, including potential anti-inflammatory and anticancer properties. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₁₇H₁₆O₅

InChI: InChI=1S/C17H16O5/c1-11(18)22-14-6-4-5-12(9-14)17(19)13-7-8-15(20-2)16(10-13)21-3/h4-10H,1-3H3

InChI key: InChIKey=WSFQGUCKUZKNKK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=C(OC)C=C1)C2=CC(OC(C)=O)=CC=C2

Synonyms:

• 3-(3,4-Dimethoxybenzoyl)phenyl acetate
• Methanone, [3-(acetyloxy)phenyl](3,4-dimethoxyphenyl)-

3-Acetoxy-3′,4′-dimethoxybenzophenone

CAS: 890100-42-2

Formula: C₁₇H₁₆O₅

Purity: 90.0%

Molecular weight: 300.31

Ref: 10-F201822