CymitQuimica logo

CAS 890100-43-3

:

Ethyl 2-[(2-chloro-3-pyridinyl)carbonyl]benzoate

Description:
Ethyl 2-[(2-chloro-3-pyridinyl)carbonyl]benzoate, with the CAS number 890100-43-3, is an organic compound characterized by its ester functional group and a pyridine ring. It features a benzoate moiety, which contributes to its aromatic properties, and a chloro-substituted pyridine, enhancing its reactivity and potential biological activity. The presence of the ethyl group indicates that it is an ester, which typically exhibits moderate volatility and solubility in organic solvents. This compound may be of interest in medicinal chemistry due to the presence of the pyridine ring, which is often associated with various pharmacological activities. Additionally, the chloro substituent can influence the compound's electronic properties and reactivity, making it a potential candidate for further chemical modifications or applications in drug development. Overall, its structural characteristics suggest that it may possess unique chemical behaviors and interactions, warranting further investigation in both synthetic and applied chemistry contexts.
Formula:C15H12ClNO3
InChI:InChI=1S/C15H12ClNO3/c1-2-20-15(19)11-7-4-3-6-10(11)13(18)12-8-5-9-17-14(12)16/h3-9H,2H2,1H3
InChI key:InChIKey=AUZCWXKJWVICAP-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(OCC)=O)C=CC=C1)C2=C(Cl)N=CC=C2
Synonyms:
  • Ethyl 2-[(2-chloro-3-pyridinyl)carbonyl]benzoate
  • Benzoic acid, 2-[(2-chloro-3-pyridinyl)carbonyl]-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.