CymitQuimica logo

CAS 890100-44-4

:

2-[2-(6-chloro-3-pyridyl)-2-oxo-ethyl]benzonitrile

Description:
2-[2-(6-chloro-3-pyridyl)-2-oxo-ethyl]benzonitrile, with the CAS number 890100-44-4, is a chemical compound characterized by its complex structure that includes a benzonitrile moiety and a pyridine derivative. This compound features a chloro substituent on the pyridine ring, which can influence its reactivity and biological activity. The presence of the carbonyl group (2-oxo) contributes to its potential as a reactive intermediate in various chemical reactions. The nitrile functional group (benzonitrile) is known for its ability to participate in nucleophilic addition reactions and can serve as a versatile building block in organic synthesis. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions, which are important considerations for its application in research and industry. Overall, this compound represents a unique structure with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H9ClN2O
InChI:InChI=1/C14H9ClN2O/c15-14-6-5-12(9-17-14)13(18)7-10-3-1-2-4-11(10)8-16/h1-6,9H,7H2
SMILES:c1ccc(C#N)c(c1)CC(=O)c1ccc(Cl)nc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.