CAS 890100-45-5
:4-(2-chloropyridine-3-carbonyl)benzonitrile
Description:
4-(2-Chloropyridine-3-carbonyl)benzonitrile, with the CAS number 890100-45-5, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and a chloropyridine group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the chloropyridine ring introduces both electron-withdrawing and steric effects, which can influence its reactivity and interactions in chemical reactions. The carbonyl group contributes to its potential as a reactive site, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, which can be explored in pharmacological studies. Its synthesis often involves multi-step reactions, highlighting its complexity and the need for careful handling due to potential toxicity associated with halogenated compounds. Overall, 4-(2-chloropyridine-3-carbonyl)benzonitrile serves as an important building block in the development of novel chemical entities.
Formula:C13H7ClN2O
InChI:InChI=1/C13H7ClN2O/c14-13-11(2-1-7-16-13)12(17)10-5-3-9(8-15)4-6-10/h1-7H
SMILES:c1cc(C(=O)c2ccc(cc2)C#N)c(Cl)nc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
