CymitQuimica logo

CAS 890100-46-6

:

(6-Chloro-3-pyridinyl)-2-thiazolylmethanone

Description:
(6-Chloro-3-pyridinyl)-2-thiazolylmethanone, with the CAS number 890100-46-6, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thiazole moiety. The presence of a chlorine atom at the 6-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound, which often exhibits diverse pharmacological properties. Its thiazole component is known for its role in various biological activities, including antimicrobial and anti-inflammatory effects. The methanone functional group indicates the presence of a carbonyl group, which can participate in various chemical reactions, enhancing the compound's versatility in synthetic applications. Overall, (6-Chloro-3-pyridinyl)-2-thiazolylmethanone is of interest in medicinal chemistry and may serve as a lead compound for the development of new therapeutic agents. Its specific properties, such as solubility and stability, would depend on the conditions under which it is studied or utilized.
Formula:C9H5ClN2OS
InChI:InChI=1S/C9H5ClN2OS/c10-7-2-1-6(5-12-7)8(13)9-11-3-4-14-9/h1-5H
InChI key:InChIKey=XGEAHBAEECOIQL-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=CC(Cl)=NC1)C2=NC=CS2
Synonyms:
  • Methanone, (6-chloro-3-pyridinyl)-2-thiazolyl-
  • (6-Chloro-3-pyridinyl)-2-thiazolylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.