CAS 890100-47-7
:Ethyl 2-[(6-chloro-3-pyridinyl)carbonyl]benzoate
Description:
Ethyl 2-[(6-chloro-3-pyridinyl)carbonyl]benzoate, identified by its CAS number 890100-47-7, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. This compound features a pyridine ring substituted with a chlorine atom at the 6-position, contributing to its unique chemical properties. The presence of the carbonyl group adjacent to the pyridine enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic attacks. Ethyl 2-[(6-chloro-3-pyridinyl)carbonyl]benzoate is typically a solid or liquid at room temperature, depending on its purity and specific formulation. It is soluble in organic solvents, which makes it useful in synthetic organic chemistry and pharmaceutical applications. The compound may exhibit biological activity, and its derivatives could be explored for potential therapeutic uses. As with many chemical substances, proper handling and safety measures should be observed due to potential toxicity or environmental impact.
Formula:C15H12ClNO3
InChI:InChI=1S/C15H12ClNO3/c1-2-20-15(19)12-6-4-3-5-11(12)14(18)10-7-8-13(16)17-9-10/h3-9H,2H2,1H3
InChI key:InChIKey=HGDSAUTYEMJTPJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(OCC)=O)C=CC=C1)C=2C=CC(Cl)=NC2
Synonyms:- 2-Chloro-5-(2-(ethoxycarbonyl)benzoyl)pyridine
- Ethyl 2-[(6-chloro-3-pyridinyl)carbonyl]benzoate
- Benzoic acid, 2-[(6-chloro-3-pyridinyl)carbonyl]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
