CAS 890100-47-7

Ethyl 2-[(6-chloro-3-pyridinyl)carbonyl]benzoate

Description:

Ethyl 2-[(6-chloro-3-pyridinyl)carbonyl]benzoate, identified by its CAS number 890100-47-7, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. This compound features a pyridine ring substituted with a chlorine atom at the 6-position, contributing to its unique chemical properties. The presence of the carbonyl group adjacent to the pyridine enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic attacks. Ethyl 2-[(6-chloro-3-pyridinyl)carbonyl]benzoate is typically a solid or liquid at room temperature, depending on its purity and specific formulation. It is soluble in organic solvents, which makes it useful in synthetic organic chemistry and pharmaceutical applications. The compound may exhibit biological activity, and its derivatives could be explored for potential therapeutic uses. As with many chemical substances, proper handling and safety measures should be observed due to potential toxicity or environmental impact.

Formula: C₁₅H₁₂ClNO₃

InChI: InChI=1S/C15H12ClNO3/c1-2-20-15(19)12-6-4-3-5-11(12)14(18)10-7-8-13(16)17-9-10/h3-9H,2H2,1H3

InChI key: InChIKey=HGDSAUTYEMJTPJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(OCC)=O)C=CC=C1)C=2C=CC(Cl)=NC2

Synonyms:

• 2-Chloro-5-(2-(ethoxycarbonyl)benzoyl)pyridine
• Ethyl 2-[(6-chloro-3-pyridinyl)carbonyl]benzoate
• Benzoic acid, 2-[(6-chloro-3-pyridinyl)carbonyl]-, ethyl ester

2-Chloro-5-(2-ethoxycarbonylbenzoyl)pyridine

CAS: 890100-47-7

Formula: C₁₅H₁₂ClNO₃

Molecular weight: 289.7137

Ref: IN-DA0042VD