CAS 890100-48-8

Ethyl 3-[(6-chloro-3-pyridinyl)carbonyl]benzoate

Description:

Ethyl 3-[(6-chloro-3-pyridinyl)carbonyl]benzoate, identified by its CAS number 890100-48-8, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. This compound features a benzoate moiety linked to a pyridine ring that is substituted with a chlorine atom at the 6-position, contributing to its unique chemical properties. The presence of the carbonyl group enhances its reactivity, making it a potential candidate for various chemical reactions, including acylation and nucleophilic substitutions. Ethyl 3-[(6-chloro-3-pyridinyl)carbonyl]benzoate may exhibit biological activity, which could be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its solubility characteristics are influenced by the ester and aromatic components, typically making it soluble in organic solvents while being less soluble in water. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.

Formula: C₁₅H₁₂ClNO₃

InChI: InChI=1S/C15H12ClNO3/c1-2-20-15(19)11-5-3-4-10(8-11)14(18)12-6-7-13(16)17-9-12/h3-9H,2H2,1H3

InChI key: InChIKey=AZYOTAZZESGZHM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C(OCC)=O)=CC=C1)C=2C=CC(Cl)=NC2

Synonyms:

• Benzoic acid, 3-[(6-chloro-3-pyridinyl)carbonyl]-, ethyl ester
• Ethyl 3-[(6-chloro-3-pyridinyl)carbonyl]benzoate

2-Chloro-5-(3-ethoxycarbonylbenzoyl)pyridine

CAS: 890100-48-8

Formula: C₁₅H₁₂ClNO₃

Molecular weight: 289.7137

Ref: IN-DA0043KK

2-Chloro-5-(3-ethoxycarbonylbenzoyl)pyridine

CAS: 890100-48-8

Formula: C₁₅H₁₂ClNO₃

Purity: 97.0%

Molecular weight: 289.72

Ref: 10-F202259