CAS 890100-52-4
:ethyl 5-(thiophene-2-carbonyl)furan-2-carboxylate
Description:
Ethyl 5-(thiophene-2-carbonyl)furan-2-carboxylate is an organic compound characterized by its unique structure, which includes a furan ring and a thiophene moiety. This compound features an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the thiophene ring suggests that it may exhibit interesting electronic properties and could be involved in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Additionally, the furan ring is known for its aromaticity and can participate in electrophilic aromatic substitution reactions. Ethyl 5-(thiophene-2-carbonyl)furan-2-carboxylate may also display biological activity, making it a candidate for further research in medicinal chemistry. Its solubility and stability in various solvents can influence its utility in synthetic pathways and applications. Overall, this compound represents a versatile building block in the field of organic chemistry, with potential implications in materials science and pharmaceuticals.
Formula:C12H10O4S
InChI:InChI=1/C12H10O4S/c1-2-15-12(14)9-6-5-8(16-9)11(13)10-4-3-7-17-10/h3-7H,2H2,1H3
SMILES:CCOC(=O)c1ccc(C(=O)c2cccs2)o1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.