CAS 890100-54-6
:ethyl 5-(furan-2-carbonyl)furan-2-carboxylate
Description:
Ethyl 5-(furan-2-carbonyl)furan-2-carboxylate, identified by its CAS number 890100-54-6, is an organic compound characterized by the presence of two furan rings and ester functional groups. This compound features a carboxylate moiety, which contributes to its reactivity and potential applications in organic synthesis. The furan rings are heterocyclic aromatic compounds that can participate in various chemical reactions, including electrophilic substitutions and cycloadditions, due to their electron-rich nature. Ethyl 5-(furan-2-carbonyl)furan-2-carboxylate may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its structural features suggest potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the presence of the ethyl ester group may influence its solubility and stability, which are important factors in its practical applications. Overall, this compound represents a unique structure that combines the properties of furan derivatives with ester functionalities, offering diverse possibilities for chemical exploration and application.
Formula:C12H10O5
InChI:InChI=1/C12H10O5/c1-2-15-12(14)10-6-5-9(17-10)11(13)8-4-3-7-16-8/h3-7H,2H2,1H3
SMILES:CCOC(=O)c1ccc(C(=O)c2ccco2)o1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
