CAS 890100-61-5
:ethyl 8-(2-chloro-3-pyridyl)-8-oxo-octanoate
Description:
Ethyl 8-(2-chloro-3-pyridyl)-8-oxo-octanoate, identified by its CAS number 890100-61-5, is an organic compound characterized by its ester functional group and a pyridine ring. This substance features a long carbon chain, specifically an octanoate moiety, which contributes to its hydrophobic properties. The presence of the 2-chloro-3-pyridyl group introduces both electronegative chlorine and nitrogen atoms, which can influence the compound's reactivity and polarity. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or agrochemical applications. The oxo group (carbonyl) enhances the compound's reactivity, making it suitable for various chemical transformations. Its solubility profile is likely to be moderate, given the balance between the hydrophobic octanoate chain and the polar pyridine ring. Overall, ethyl 8-(2-chloro-3-pyridyl)-8-oxo-octanoate is a complex molecule with potential applications in medicinal chemistry and related fields.
Formula:C15H20ClNO3
InChI:InChI=1/C15H20ClNO3/c1-2-20-14(19)10-6-4-3-5-9-13(18)12-8-7-11-17-15(12)16/h7-8,11H,2-6,9-10H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1cccnc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
