CAS 890100-63-7
:Ethyl 6-chloro-γ-oxo-3-pyridinebutanoate
Description:
Ethyl 6-chloro-γ-oxo-3-pyridinebutanoate, identified by its CAS number 890100-63-7, is an organic compound that features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound is characterized by the presence of a chloro substituent at the 6-position of the pyridine ring and an ethyl ester functional group, which contributes to its reactivity and solubility properties. The γ-oxo group indicates the presence of a carbonyl (C=O) functional group adjacent to the pyridine ring, which can influence its chemical behavior, including potential reactivity in nucleophilic addition reactions. Ethyl 6-chloro-γ-oxo-3-pyridinebutanoate may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest it could participate in various chemical reactions, including esterification and substitution reactions, and it may serve as a precursor for the synthesis of more complex molecules. As with many organic compounds, its physical properties, such as solubility and boiling point, would depend on the specific conditions and purity of the substance.
Formula:C11H12ClNO3
InChI:InChI=1S/C11H12ClNO3/c1-2-16-11(15)6-4-9(14)8-3-5-10(12)13-7-8/h3,5,7H,2,4,6H2,1H3
InChI key:InChIKey=JLOMUGLRAOGWJH-UHFFFAOYSA-N
SMILES:C(CCC(OCC)=O)(=O)C=1C=CC(Cl)=NC1
Synonyms:- 3-Pyridinebutanoic acid, 6-chloro-γ-oxo-, ethyl ester
- Ethyl 6-chloro-γ-oxo-3-pyridinebutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
