CymitQuimica logo

CAS 890100-65-9

:

ethyl 5-(6-chloro-3-pyridyl)-5-oxo-pentanoate

Description:
Ethyl 5-(6-chloro-3-pyridyl)-5-oxo-pentanoate, identified by its CAS number 890100-65-9, is a chemical compound that belongs to the class of esters. It features a pyridine ring substituted with a chlorine atom, which contributes to its unique chemical properties. The presence of the 5-oxo group indicates that it contains a carbonyl functional group, which is characteristic of ketones and can influence reactivity and stability. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structure suggests potential biological activity, which could be explored in medicinal chemistry. The compound is likely to exhibit moderate solubility in organic solvents, while its polar functional groups may affect its interactions with biological systems. Safety data and handling precautions should be considered, as with any chemical substance, particularly due to the presence of the chlorine atom, which can impart toxicity or environmental concerns.
Formula:C12H14ClNO3
InChI:InChI=1/C12H14ClNO3/c1-2-17-12(16)5-3-4-10(15)9-6-7-11(13)14-8-9/h6-8H,2-5H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1ccc(Cl)nc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.