CAS 890100-72-8
:ethyl 8-(6-chloro-3-pyridyl)-8-oxo-octanoate
Description:
Ethyl 8-(6-chloro-3-pyridyl)-8-oxo-octanoate is a chemical compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethyl alcohol) and a carboxylic acid. This compound features a pyridine ring, which contributes to its biological activity and potential pharmacological properties. The presence of the chloro substituent on the pyridine ring may enhance its reactivity and influence its interaction with biological targets. The octanoate chain provides a hydrophobic character, which can affect the compound's solubility and permeability in biological systems. Ethyl 8-(6-chloro-3-pyridyl)-8-oxo-octanoate may exhibit various properties such as antimicrobial, anti-inflammatory, or other therapeutic effects, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many chemical substances, safety and handling precautions are essential due to the presence of chlorine and the potential for biological activity.
Formula:C15H20ClNO3
InChI:InChI=1/C15H20ClNO3/c1-2-20-15(19)8-6-4-3-5-7-13(18)12-9-10-14(16)17-11-12/h9-11H,2-8H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1ccc(Cl)nc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
