CAS 890100-74-0
:2-Chloro-γ-oxo-3-pyridinebutanenitrile
Description:
2-Chloro-γ-oxo-3-pyridinebutanenitrile is a chemical compound characterized by its unique structure, which includes a pyridine ring and a nitrile functional group. The presence of the chloro substituent indicates that it has a chlorine atom attached to the carbon chain, which can influence its reactivity and solubility. The γ-oxo group suggests that there is a carbonyl (C=O) functional group located at the gamma position relative to the nitrile, contributing to the compound's potential as a reactive intermediate in various chemical reactions. This compound may exhibit polar characteristics due to the nitrile and carbonyl groups, affecting its solubility in polar solvents. Additionally, the presence of the pyridine ring can impart basicity and influence the compound's interaction with biological systems, making it of interest in medicinal chemistry. Overall, 2-Chloro-γ-oxo-3-pyridinebutanenitrile is a versatile compound with potential applications in pharmaceuticals and organic synthesis, although specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C9H7ClN2O
InChI:InChI=1S/C9H7ClN2O/c10-9-7(3-2-6-12-9)8(13)4-1-5-11/h2-3,6H,1,4H2
InChI key:InChIKey=JLVICPHSNYPCOT-UHFFFAOYSA-N
SMILES:C(CCC#N)(=O)C1=C(Cl)N=CC=C1
Synonyms:- 3-Pyridinebutanenitrile, 2-chloro-γ-oxo-
- 2-Chloro-γ-oxo-3-pyridinebutanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.