CAS 890100-76-2
:2-Chloro-δ-oxo-3-pyridinepentanenitrile
Description:
2-Chloro-δ-oxo-3-pyridinepentanenitrile, identified by its CAS number 890100-76-2, is a chemical compound that features a pyridine ring, a nitrile group, and a chloro substituent. This compound is characterized by its unique structural framework, which includes a five-carbon chain with a carbonyl (ketone) functional group and a cyano group (nitrile) attached to it. The presence of the chloro group introduces additional reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The pyridine moiety contributes to the compound's aromaticity and can influence its solubility and reactivity in different solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific physical properties, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, 2-Chloro-δ-oxo-3-pyridinepentanenitrile represents a versatile structure with potential applications in various fields of chemistry.
Formula:C10H9ClN2O
InChI:InChI=1S/C10H9ClN2O/c11-10-8(4-3-7-13-10)9(14)5-1-2-6-12/h3-4,7H,1-2,5H2
InChI key:InChIKey=AJPJQBOWWOLZLI-UHFFFAOYSA-N
SMILES:C(CCCC#N)(=O)C1=C(Cl)N=CC=C1
Synonyms:- 3-Pyridinepentanenitrile, 2-chloro-δ-oxo-
- 2-Chloro-δ-oxo-3-pyridinepentanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
