CAS 890100-82-0
:2-Chloro-η-oxo-3-pyridineoctanenitrile
Description:
2-Chloro-η-oxo-3-pyridineoctanenitrile, identified by its CAS number 890100-82-0, is a chemical compound that features a pyridine ring, a nitrile group, and a chloro substituent. The presence of the chloro group indicates that it is a halogenated compound, which can influence its reactivity and solubility. The nitrile functional group (-C≡N) is known for its ability to participate in various chemical reactions, including nucleophilic additions and hydrolysis, making this compound potentially useful in synthetic organic chemistry. The "η-oxo" designation suggests the presence of a carbonyl group (C=O), which can further enhance the compound's reactivity. This compound may exhibit polar characteristics due to the electronegative chlorine and the nitrile group, affecting its solubility in polar solvents. Additionally, the structural complexity of the compound may lead to interesting biological activities, although specific biological data would require further investigation. Overall, 2-Chloro-η-oxo-3-pyridineoctanenitrile is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H15ClN2O
InChI:InChI=1S/C13H15ClN2O/c14-13-11(7-6-10-16-13)12(17)8-4-2-1-3-5-9-15/h6-7,10H,1-5,8H2
InChI key:InChIKey=RKAWYAMDRRQJIK-UHFFFAOYSA-N
SMILES:C(CCCCCCC#N)(=O)C1=C(Cl)N=CC=C1
Synonyms:- 2-Chloro-η-oxo-3-pyridineoctanenitrile
- 3-Pyridineoctanenitrile, 2-chloro-η-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
