CymitQuimica logo

CAS 890100-88-6

:

6-Chloro-ε-oxo-3-pyridinehexanenitrile

Description:
6-Chloro-ε-oxo-3-pyridinehexanenitrile, with the CAS number 890100-88-6, is a chemical compound that features a pyridine ring, a nitrile group, and a chloro substituent. Its structure includes a six-carbon chain with a carbonyl (keto) functional group and a cyano group, which contribute to its reactivity and potential applications in organic synthesis. The presence of the chloro group can enhance the compound's electrophilicity, making it useful in various chemical reactions, such as nucleophilic substitutions. This compound may exhibit biological activity, which could be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Additionally, its unique functional groups suggest potential applications in materials science and agrochemicals. As with many nitriles, it may have specific handling and safety considerations due to its potential toxicity and reactivity. Overall, 6-Chloro-ε-oxo-3-pyridinehexanenitrile is a versatile compound with a range of possible applications in both research and industry.
Formula:C11H11ClN2O
InChI:InChI=1S/C11H11ClN2O/c12-11-6-5-9(8-14-11)10(15)4-2-1-3-7-13/h5-6,8H,1-4H2
InChI key:InChIKey=XEJINAYBFOJRPJ-UHFFFAOYSA-N
SMILES:C(CCCCC#N)(=O)C=1C=CC(Cl)=NC1
Synonyms:
  • 3-Pyridinehexanenitrile, 6-chloro-ε-oxo-
  • 6-Chloro-ε-oxo-3-pyridinehexanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.