CymitQuimica logo

CAS 890100-90-0

:

7-(6-chloro-3-pyridyl)-7-oxo-heptanenitrile

Description:
7-(6-Chloro-3-pyridyl)-7-oxo-heptanenitrile is a chemical compound characterized by its unique structure, which includes a heptane backbone, a nitrile functional group, and a pyridine ring substituted with a chlorine atom. The presence of the 7-oxo group indicates a ketone functionality, contributing to the compound's reactivity and potential applications in organic synthesis. The chlorine atom on the pyridine ring can influence the compound's electronic properties and reactivity, making it a useful intermediate in medicinal chemistry and agrochemical development. This compound may exhibit biological activity due to its structural features, which can interact with various biological targets. Its molecular weight, solubility, and stability under different conditions would be essential for practical applications. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 7-(6-chloro-3-pyridyl)-7-oxo-heptanenitrile represents a versatile structure in the realm of synthetic organic chemistry.
Formula:C12H13ClN2O
InChI:InChI=1/C12H13ClN2O/c13-12-7-6-10(9-15-12)11(16)5-3-1-2-4-8-14/h6-7,9H,1-5H2
SMILES:C(CCC#N)CCC(=O)c1ccc(Cl)nc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.