CAS 890100-92-2
:6-Chloro-η-oxo-3-pyridineoctanenitrile
Description:
6-Chloro-η-oxo-3-pyridineoctanenitrile, identified by its CAS number 890100-92-2, is a chemical compound that features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro substituent indicates that a chlorine atom is attached to the sixth position of the pyridine ring, while the "η-oxo" suggests the presence of a carbonyl group (C=O) in the structure, contributing to its reactivity and potential applications. The octanenitrile portion of the name indicates that the compound contains a long carbon chain (octane) terminated by a nitrile group (–C≡N), which is known for its polar character and ability to participate in various chemical reactions. This compound may exhibit properties typical of both pyridine derivatives and nitriles, such as solubility in polar solvents and potential biological activity. Its specific applications and reactivity would depend on the functional groups present and the overall molecular structure, making it of interest in fields such as medicinal chemistry and materials science.
Formula:C13H15ClN2O
InChI:InChI=1S/C13H15ClN2O/c14-13-8-7-11(10-16-13)12(17)6-4-2-1-3-5-9-15/h7-8,10H,1-6H2
InChI key:InChIKey=OBHXAROWGWBBSM-UHFFFAOYSA-N
SMILES:C(CCCCCCC#N)(=O)C=1C=CC(Cl)=NC1
Synonyms:- 3-Pyridineoctanenitrile, 6-chloro-η-oxo-
- 6-Chloro-η-oxo-3-pyridineoctanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
